C15H21ClF2O — CID 79887959
5-(chloromethyl)-2-(2-ethylhexoxy)-1,3-difluorobenzene (PubChem CID 79887959) has the molecular formula C15H21ClF2O and a molecular weight of 290.78 g/mol. Its IUPAC name is 5-(chloromethyl)-2-(2-ethylhexoxy)-1,3-difluorobenzene.
| Compound Name | 5-(chloromethyl)-2-(2-ethylhexoxy)-1,3-difluorobenzene |
|---|---|
| PubChem CID | 79887959 |
| Molecular Formula | C15H21ClF2O |
| Molecular Weight | 290.78 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 5-(chloromethyl)-2-(2-ethylhexoxy)-1,3-difluorobenzene |
| SMILES | CCCCC(CC)COc1c(F)cc(CCl)cc1F |
| InChI | InChI=1S/C15H21ClF2O/c1-3-5-6-11(4-2)10-19-15-13(17)7-12(9-16)8-14(15)18/h7-8,11H,3-6,9-10H2,1-2H3 |
| InChIKey | OLZHUYNWOLRJIS-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.78 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|