C46H74O4 — CID 139930225
2,6,9,10-tetrakis(2-ethylhexoxy)anthracene (PubChem CID 139930225) has the molecular formula C46H74O4 and a molecular weight of 691.09 g/mol. Its IUPAC name is 2,6,9,10-tetrakis(2-ethylhexoxy)anthracene.
| Compound Name | 2,6,9,10-tetrakis(2-ethylhexoxy)anthracene |
|---|---|
| PubChem CID | 139930225 |
| Molecular Formula | C46H74O4 |
| Molecular Weight | 691.09 g/mol |
| Exact Mass | 690.56 |
| IUPAC Name | 2,6,9,10-tetrakis(2-ethylhexoxy)anthracene |
| SMILES | CCCCC(CC)COc1ccc2c(OCC(CC)CCCC)c3cc(OCC(CC)CCCC)ccc3c(OCC(CC)CCCC)c2c1 |
| InChI | InChI=1S/C46H74O4/c1-9-17-21-35(13-5)31-47-39-25-27-41-43(29-39)45(49-33-37(15-7)23-19-11-3)42-28-26-40(48-32-36(14-6)22-18-10-2)30-44(42)46(41)50-34-38(16-8)24-20-12-4/h25-30,35-38H,9-24,31-34H2,1-8H3 |
| InChIKey | HNMADPCABIZUHR-UHFFFAOYSA-N |
| XLogP | 14.37 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.09 |
| LogP ≤ 5 | 14.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|