C40H49NO2 — CID 67067487
3,6-bis[4-(2-ethylhexoxy)phenyl]-9H-carbazole (PubChem CID 67067487) has the molecular formula C40H49NO2 and a molecular weight of 575.84 g/mol. Its IUPAC name is 3,6-bis[4-(2-ethylhexoxy)phenyl]-9H-carbazole.
| Compound Name | 3,6-bis[4-(2-ethylhexoxy)phenyl]-9H-carbazole |
|---|---|
| PubChem CID | 67067487 |
| Molecular Formula | C40H49NO2 |
| Molecular Weight | 575.84 g/mol |
| Exact Mass | 575.38 |
| IUPAC Name | 3,6-bis[4-(2-ethylhexoxy)phenyl]-9H-carbazole |
| SMILES | CCCCC(CC)COc1ccc(-c2ccc3[nH]c4ccc(-c5ccc(OCC(CC)CCCC)cc5)cc4c3c2)cc1 |
| InChI | InChI=1S/C40H49NO2/c1-5-9-11-29(7-3)27-42-35-19-13-31(14-20-35)33-17-23-39-37(25-33)38-26-34(18-24-40(38)41-39)32-15-21-36(22-16-32)43-28-30(8-4)12-10-6-2/h13-26,29-30,41H,5-12,27-28H2,1-4H3 |
| InChIKey | BXVUBDSXYHXRSE-UHFFFAOYSA-N |
| XLogP | 11.85 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.84 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |