C17H23N3O2 — CID 22363294
6-[4-(2-ethylhexoxy)phenyl]-1H-1,3,5-triazin-2-one (PubChem CID 22363294) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 6-[4-(2-ethylhexoxy)phenyl]-1H-1,3,5-triazin-2-one.
| Compound Name | 6-[4-(2-ethylhexoxy)phenyl]-1H-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 22363294 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 6-[4-(2-ethylhexoxy)phenyl]-1H-1,3,5-triazin-2-one |
| SMILES | CCCCC(CC)COc1ccc(-c2ncnc(=O)[nH]2)cc1 |
| InChI | InChI=1S/C17H23N3O2/c1-3-5-6-13(4-2)11-22-15-9-7-14(8-10-15)16-18-12-19-17(21)20-16/h7-10,12-13H,3-6,11H2,1-2H3,(H,18,19,20,21) |
| InChIKey | NQMLCCISRDQDCE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |