C36H48N2O2S — CID 102046385
2,3-bis[4-(2-ethylhexoxy)phenyl]-5,7-dimethylthieno[3,4-b]pyrazine (PubChem CID 102046385) has the molecular formula C36H48N2O2S and a molecular weight of 572.86 g/mol. Its IUPAC name is 2,3-bis[4-(2-ethylhexoxy)phenyl]-5,7-dimethylthieno[3,4-b]pyrazine.
| Compound Name | 2,3-bis[4-(2-ethylhexoxy)phenyl]-5,7-dimethylthieno[3,4-b]pyrazine |
|---|---|
| PubChem CID | 102046385 |
| Molecular Formula | C36H48N2O2S |
| Molecular Weight | 572.86 g/mol |
| Exact Mass | 572.34 |
| IUPAC Name | 2,3-bis[4-(2-ethylhexoxy)phenyl]-5,7-dimethylthieno[3,4-b]pyrazine |
| SMILES | CCCCC(CC)COc1ccc(-c2nc3c(C)sc(C)c3nc2-c2ccc(OCC(CC)CCCC)cc2)cc1 |
| InChI | InChI=1S/C36H48N2O2S/c1-7-11-13-27(9-3)23-39-31-19-15-29(16-20-31)35-36(38-34-26(6)41-25(5)33(34)37-35)30-17-21-32(22-18-30)40-24-28(10-4)14-12-8-2/h15-22,27-28H,7-14,23-24H2,1-6H3 |
| InChIKey | RZIACYLKBDJRMI-UHFFFAOYSA-N |
| XLogP | 10.83 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.86 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |