C37H47N3O4 — CID 135563262
4-[4,6-bis[4-(2-ethylhexoxy)phenyl]-1,3,5-triazin-2-yl]benzene-1,3-diol (PubChem CID 135563262) has the molecular formula C37H47N3O4 and a molecular weight of 597.80 g/mol. Its IUPAC name is 4-[4,6-bis[4-(2-ethylhexoxy)phenyl]-1,3,5-triazin-2-yl]benzene-1,3-diol.
| Compound Name | 4-[4,6-bis[4-(2-ethylhexoxy)phenyl]-1,3,5-triazin-2-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 135563262 |
| Molecular Formula | C37H47N3O4 |
| Molecular Weight | 597.80 g/mol |
| Exact Mass | 597.36 |
| IUPAC Name | 4-[4,6-bis[4-(2-ethylhexoxy)phenyl]-1,3,5-triazin-2-yl]benzene-1,3-diol |
| SMILES | CCCCC(CC)COc1ccc(-c2nc(-c3ccc(OCC(CC)CCCC)cc3)nc(-c3ccc(O)cc3O)n2)cc1 |
| InChI | InChI=1S/C37H47N3O4/c1-5-9-11-26(7-3)24-43-31-18-13-28(14-19-31)35-38-36(40-37(39-35)33-22-17-30(41)23-34(33)42)29-15-20-32(21-16-29)44-25-27(8-4)12-10-6-2/h13-23,26-27,41-42H,5-12,24-25H2,1-4H3 |
| InChIKey | RLMODPKLBPDGGO-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 97.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.80 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |