C33H35N3O3 — CID 164768338
5-ethoxy-2-[4-(2-ethylhexoxy)-6-phenanthren-9-yl-1,3,5-triazin-2-yl]phenol (PubChem CID 164768338) has the molecular formula C33H35N3O3 and a molecular weight of 521.66 g/mol. Its IUPAC name is 5-ethoxy-2-[4-(2-ethylhexoxy)-6-phenanthren-9-yl-1,3,5-triazin-2-yl]phenol.
| Compound Name | 5-ethoxy-2-[4-(2-ethylhexoxy)-6-phenanthren-9-yl-1,3,5-triazin-2-yl]phenol |
|---|---|
| PubChem CID | 164768338 |
| Molecular Formula | C33H35N3O3 |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.27 |
| IUPAC Name | 5-ethoxy-2-[4-(2-ethylhexoxy)-6-phenanthren-9-yl-1,3,5-triazin-2-yl]phenol |
| SMILES | CCCCC(CC)COc1nc(-c2ccc(OCC)cc2O)nc(-c2cc3ccccc3c3ccccc23)n1 |
| InChI | InChI=1S/C33H35N3O3/c1-4-7-12-22(5-2)21-39-33-35-31(28-18-17-24(38-6-3)20-30(28)37)34-32(36-33)29-19-23-13-8-9-14-25(23)26-15-10-11-16-27(26)29/h8-11,13-20,22,37H,4-7,12,21H2,1-3H3 |
| InChIKey | GQGAWIMFIIHPHH-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 77.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|