C36H39N3O4 — CID 164768665
2-(4-cyclopentyloxy-6-phenanthren-9-yl-1,3,5-triazin-2-yl)-5-(2-ethylhexoxy)benzene-1,3-diol (PubChem CID 164768665) has the molecular formula C36H39N3O4 and a molecular weight of 577.73 g/mol. Its IUPAC name is 2-(4-cyclopentyloxy-6-phenanthren-9-yl-1,3,5-triazin-2-yl)-5-(2-ethylhexoxy)benzene-1,3-diol.
| Compound Name | 2-(4-cyclopentyloxy-6-phenanthren-9-yl-1,3,5-triazin-2-yl)-5-(2-ethylhexoxy)benzene-1,3-diol |
|---|---|
| PubChem CID | 164768665 |
| Molecular Formula | C36H39N3O4 |
| Molecular Weight | 577.73 g/mol |
| Exact Mass | 577.29 |
| IUPAC Name | 2-(4-cyclopentyloxy-6-phenanthren-9-yl-1,3,5-triazin-2-yl)-5-(2-ethylhexoxy)benzene-1,3-diol |
| SMILES | CCCCC(CC)COc1cc(O)c(-c2nc(OC3CCCC3)nc(-c3cc4ccccc4c4ccccc34)n2)c(O)c1 |
| InChI | InChI=1S/C36H39N3O4/c1-3-5-12-23(4-2)22-42-26-20-31(40)33(32(41)21-26)35-37-34(38-36(39-35)43-25-14-7-8-15-25)30-19-24-13-6-9-16-27(24)28-17-10-11-18-29(28)30/h6,9-11,13,16-21,23,25,40-41H,3-5,7-8,12,14-15,22H2,1-2H3 |
| InChIKey | CXNNBDCRONOQSN-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 97.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.73 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|