C25H19N3O4 — CID 164768748
2-(4-ethoxy-6-phenanthren-9-yl-1,3,5-triazin-2-yl)benzene-1,3,5-triol (PubChem CID 164768748) has the molecular formula C25H19N3O4 and a molecular weight of 425.44 g/mol. Its IUPAC name is 2-(4-ethoxy-6-phenanthren-9-yl-1,3,5-triazin-2-yl)benzene-1,3,5-triol.
| Compound Name | 2-(4-ethoxy-6-phenanthren-9-yl-1,3,5-triazin-2-yl)benzene-1,3,5-triol |
|---|---|
| PubChem CID | 164768748 |
| Molecular Formula | C25H19N3O4 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 2-(4-ethoxy-6-phenanthren-9-yl-1,3,5-triazin-2-yl)benzene-1,3,5-triol |
| SMILES | CCOc1nc(-c2c(O)cc(O)cc2O)nc(-c2cc3ccccc3c3ccccc23)n1 |
| InChI | InChI=1S/C25H19N3O4/c1-2-32-25-27-23(26-24(28-25)22-20(30)12-15(29)13-21(22)31)19-11-14-7-3-4-8-16(14)17-9-5-6-10-18(17)19/h3-13,29-31H,2H2,1H3 |
| InChIKey | LQCDAMNVXQHNNA-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 108.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|