C27H23N3O3 — CID 164768740
2-(4-anthracen-9-yl-6-ethoxy-1,3,5-triazin-2-yl)-5-ethoxyphenol (PubChem CID 164768740) has the molecular formula C27H23N3O3 and a molecular weight of 437.50 g/mol. Its IUPAC name is 2-(4-anthracen-9-yl-6-ethoxy-1,3,5-triazin-2-yl)-5-ethoxyphenol.
| Compound Name | 2-(4-anthracen-9-yl-6-ethoxy-1,3,5-triazin-2-yl)-5-ethoxyphenol |
|---|---|
| PubChem CID | 164768740 |
| Molecular Formula | C27H23N3O3 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 2-(4-anthracen-9-yl-6-ethoxy-1,3,5-triazin-2-yl)-5-ethoxyphenol |
| SMILES | CCOc1ccc(-c2nc(OCC)nc(-c3c4ccccc4cc4ccccc34)n2)c(O)c1 |
| InChI | InChI=1S/C27H23N3O3/c1-3-32-19-13-14-22(23(31)16-19)25-28-26(30-27(29-25)33-4-2)24-20-11-7-5-9-17(20)15-18-10-6-8-12-21(18)24/h5-16,31H,3-4H2,1-2H3 |
| InChIKey | CKDMQKQSCNQUPY-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 77.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|