C23H27N3O5 — CID 135597459
2-[4-butoxy-6-(4-ethoxy-2-hydroxyphenyl)-1,3,5-triazin-2-yl]-5-ethoxyphenol (PubChem CID 135597459) has the molecular formula C23H27N3O5 and a molecular weight of 425.49 g/mol. Its IUPAC name is 2-[4-butoxy-6-(4-ethoxy-2-hydroxyphenyl)-1,3,5-triazin-2-yl]-5-ethoxyphenol.
| Compound Name | 2-[4-butoxy-6-(4-ethoxy-2-hydroxyphenyl)-1,3,5-triazin-2-yl]-5-ethoxyphenol |
|---|---|
| PubChem CID | 135597459 |
| Molecular Formula | C23H27N3O5 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 2-[4-butoxy-6-(4-ethoxy-2-hydroxyphenyl)-1,3,5-triazin-2-yl]-5-ethoxyphenol |
| SMILES | CCCCOc1nc(-c2ccc(OCC)cc2O)nc(-c2ccc(OCC)cc2O)n1 |
| InChI | InChI=1S/C23H27N3O5/c1-4-7-12-31-23-25-21(17-10-8-15(29-5-2)13-19(17)27)24-22(26-23)18-11-9-16(30-6-3)14-20(18)28/h8-11,13-14,27-28H,4-7,12H2,1-3H3 |
| InChIKey | IEZGLQLYKGRESO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 106.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|