C66H78N6O4 — CID 161357419
2-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-5-octoxyphenol (PubChem CID 161357419) has the molecular formula C66H78N6O4 and a molecular weight of 1019.39 g/mol. Its IUPAC name is 2-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-5-octoxyphenol.
| Compound Name | 2-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-5-octoxyphenol |
|---|---|
| PubChem CID | 161357419 |
| Molecular Formula | C66H78N6O4 |
| Molecular Weight | 1019.39 g/mol |
| Exact Mass | 1018.61 |
| IUPAC Name | 2-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-5-octoxyphenol |
| SMILES | CCCCCCCCOc1ccc(-c2nc(-c3ccc(C)cc3C)nc(-c3ccc(C)cc3C)n2)c(O)c1.CCCCCCCCOc1ccc(-c2nc(-c3ccc(C)cc3C)nc(-c3ccc(C)cc3C)n2)c(O)c1 |
| InChI | InChI=1S/2C33H39N3O2/c2*1-6-7-8-9-10-11-18-38-26-14-17-29(30(37)21-26)33-35-31(27-15-12-22(2)19-24(27)4)34-32(36-33)28-16-13-23(3)20-25(28)5/h2*12-17,19-21,37H,6-11,18H2,1-5H3 |
| InChIKey | VOSLIAHCBWYLLZ-UHFFFAOYSA-N |
| XLogP | 17.10 |
| TPSA | 136.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1019.39 |
| LogP ≤ 5 | 17.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|