C24H29N3O2 — CID 141239106
2-[4-(2-methylphenyl)-1,3,5-triazin-2-yl]-5-octoxyphenol (PubChem CID 141239106) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is 2-[4-(2-methylphenyl)-1,3,5-triazin-2-yl]-5-octoxyphenol.
| Compound Name | 2-[4-(2-methylphenyl)-1,3,5-triazin-2-yl]-5-octoxyphenol |
|---|---|
| PubChem CID | 141239106 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 2-[4-(2-methylphenyl)-1,3,5-triazin-2-yl]-5-octoxyphenol |
| SMILES | CCCCCCCCOc1ccc(-c2ncnc(-c3ccccc3C)n2)c(O)c1 |
| InChI | InChI=1S/C24H29N3O2/c1-3-4-5-6-7-10-15-29-19-13-14-21(22(28)16-19)24-26-17-25-23(27-24)20-12-9-8-11-18(20)2/h8-9,11-14,16-17,28H,3-7,10,15H2,1-2H3 |
| InChIKey | UPVXMGWBFSSDHD-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 68.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|