C35H43Cl2N3O2 — CID 158984811
2-[4,6-bis(4-chlorophenyl)-1,3,5-triazin-2-yl]-5-hexoxyphenol;octane (PubChem CID 158984811) has the molecular formula C35H43Cl2N3O2 and a molecular weight of 608.65 g/mol. Its IUPAC name is 2-[4,6-bis(4-chlorophenyl)-1,3,5-triazin-2-yl]-5-hexoxyphenol;octane.
| Compound Name | 2-[4,6-bis(4-chlorophenyl)-1,3,5-triazin-2-yl]-5-hexoxyphenol;octane |
|---|---|
| PubChem CID | 158984811 |
| Molecular Formula | C35H43Cl2N3O2 |
| Molecular Weight | 608.65 g/mol |
| Exact Mass | 607.27 |
| IUPAC Name | 2-[4,6-bis(4-chlorophenyl)-1,3,5-triazin-2-yl]-5-hexoxyphenol;octane |
| SMILES | CCCCCCCC.CCCCCCOc1ccc(-c2nc(-c3ccc(Cl)cc3)nc(-c3ccc(Cl)cc3)n2)c(O)c1 |
| InChI | InChI=1S/C27H25Cl2N3O2.C8H18/c1-2-3-4-5-16-34-22-14-15-23(24(33)17-22)27-31-25(18-6-10-20(28)11-7-18)30-26(32-27)19-8-12-21(29)13-9-19;1-3-5-7-8-6-4-2/h6-15,17,33H,2-5,16H2,1H3;3-8H2,1-2H3 |
| InChIKey | JPLDMRQNEJNCGJ-UHFFFAOYSA-N |
| XLogP | 11.21 |
| TPSA | 68.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.65 |
| LogP ≤ 5 | 11.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|