C42H39N3O4 — CID 158677029
[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenyl] octyl carbonate (PubChem CID 158677029) has the molecular formula C42H39N3O4 and a molecular weight of 649.79 g/mol. Its IUPAC name is [4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenyl] octyl carbonate.
| Compound Name | [4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenyl] octyl carbonate |
|---|---|
| PubChem CID | 158677029 |
| Molecular Formula | C42H39N3O4 |
| Molecular Weight | 649.79 g/mol |
| Exact Mass | 649.29 |
| IUPAC Name | [4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenyl] octyl carbonate |
| SMILES | CCCCCCCCOC(=O)Oc1ccc(-c2nc(-c3ccc(-c4ccccc4)cc3)nc(-c3ccc(-c4ccccc4)cc3)n2)c(O)c1 |
| InChI | InChI=1S/C42H39N3O4/c1-2-3-4-5-6-13-28-48-42(47)49-36-26-27-37(38(46)29-36)41-44-39(34-22-18-32(19-23-34)30-14-9-7-10-15-30)43-40(45-41)35-24-20-33(21-25-35)31-16-11-8-12-17-31/h7-12,14-27,29,46H,2-6,13,28H2,1H3 |
| InChIKey | IEQOBQRKCCUZCS-UHFFFAOYSA-N |
| XLogP | 10.79 |
| TPSA | 94.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.79 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|