C45H45N3O4 — CID 163582279
3-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]-1-octan-2-yloxybutan-2-one (PubChem CID 163582279) has the molecular formula C45H45N3O4 and a molecular weight of 691.87 g/mol. Its IUPAC name is 3-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]-1-octan-2-yloxybutan-2-one.
| Compound Name | 3-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]-1-octan-2-yloxybutan-2-one |
|---|---|
| PubChem CID | 163582279 |
| Molecular Formula | C45H45N3O4 |
| Molecular Weight | 691.87 g/mol |
| Exact Mass | 691.34 |
| IUPAC Name | 3-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]-1-octan-2-yloxybutan-2-one |
| SMILES | CCCCCCC(C)OCC(=O)C(C)Oc1ccc(-c2nc(-c3ccc(-c4ccccc4)cc3)nc(-c3ccc(-c4ccccc4)cc3)n2)c(O)c1 |
| InChI | InChI=1S/C45H45N3O4/c1-4-5-6-9-14-31(2)51-30-42(50)32(3)52-39-27-28-40(41(49)29-39)45-47-43(37-23-19-35(20-24-37)33-15-10-7-11-16-33)46-44(48-45)38-25-21-36(22-26-38)34-17-12-8-13-18-34/h7-8,10-13,15-29,31-32,49H,4-6,9,14,30H2,1-3H3 |
| InChIKey | NNEZUHHVJYDWAY-UHFFFAOYSA-N |
| XLogP | 10.62 |
| TPSA | 94.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.87 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|