C48H53N3O5 — CID 175139599
2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-hexoxyphenol;(2-hydroxy-4-octoxyphenyl)-phenylmethanone (PubChem CID 175139599) has the molecular formula C48H53N3O5 and a molecular weight of 751.97 g/mol. Its IUPAC name is 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-hexoxyphenol;(2-hydroxy-4-octoxyphenyl)-phenylmethanone.
| Compound Name | 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-hexoxyphenol;(2-hydroxy-4-octoxyphenyl)-phenylmethanone |
|---|---|
| PubChem CID | 175139599 |
| Molecular Formula | C48H53N3O5 |
| Molecular Weight | 751.97 g/mol |
| Exact Mass | 751.40 |
| IUPAC Name | 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-hexoxyphenol;(2-hydroxy-4-octoxyphenyl)-phenylmethanone |
| SMILES | CCCCCCCCOc1ccc(C(=O)c2ccccc2)c(O)c1.CCCCCCOc1ccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c(O)c1 |
| InChI | InChI=1S/C27H27N3O2.C21H26O3/c1-2-3-4-11-18-32-22-16-17-23(24(31)19-22)27-29-25(20-12-7-5-8-13-20)28-26(30-27)21-14-9-6-10-15-21;1-2-3-4-5-6-10-15-24-18-13-14-19(20(22)16-18)21(23)17-11-8-7-9-12-17/h5-10,12-17,19,31H,2-4,11,18H2,1H3;7-9,11-14,16,22H,2-6,10,15H2,1H3 |
| InChIKey | XFFZKYNVPCJTCQ-UHFFFAOYSA-N |
| XLogP | 11.90 |
| TPSA | 114.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.97 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|