C38H44O6 — CID 67726812
(4-butoxy-2-hydroxyphenyl)-phenylmethanone;(2-hydroxy-4-octoxyphenyl)-phenylmethanone (PubChem CID 67726812) has the molecular formula C38H44O6 and a molecular weight of 596.76 g/mol. Its IUPAC name is (4-butoxy-2-hydroxyphenyl)-phenylmethanone;(2-hydroxy-4-octoxyphenyl)-phenylmethanone.
| Compound Name | (4-butoxy-2-hydroxyphenyl)-phenylmethanone;(2-hydroxy-4-octoxyphenyl)-phenylmethanone |
|---|---|
| PubChem CID | 67726812 |
| Molecular Formula | C38H44O6 |
| Molecular Weight | 596.76 g/mol |
| Exact Mass | 596.31 |
| IUPAC Name | (4-butoxy-2-hydroxyphenyl)-phenylmethanone;(2-hydroxy-4-octoxyphenyl)-phenylmethanone |
| SMILES | CCCCCCCCOc1ccc(C(=O)c2ccccc2)c(O)c1.CCCCOc1ccc(C(=O)c2ccccc2)c(O)c1 |
| InChI | InChI=1S/C21H26O3.C17H18O3/c1-2-3-4-5-6-10-15-24-18-13-14-19(20(22)16-18)21(23)17-11-8-7-9-12-17;1-2-3-11-20-14-9-10-15(16(18)12-14)17(19)13-7-5-4-6-8-13/h7-9,11-14,16,22H,2-6,10,15H2,1H3;4-10,12,18H,2-3,11H2,1H3 |
| InChIKey | FTDVIEQXVAOMPA-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.76 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|