C19H22O4 — CID 19832534
(4-hexoxy-2-hydroxyphenyl)-(2-hydroxyphenyl)methanone (PubChem CID 19832534) has the molecular formula C19H22O4 and a molecular weight of 314.38 g/mol. Its IUPAC name is (4-hexoxy-2-hydroxyphenyl)-(2-hydroxyphenyl)methanone.
| Compound Name | (4-hexoxy-2-hydroxyphenyl)-(2-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 19832534 |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | (4-hexoxy-2-hydroxyphenyl)-(2-hydroxyphenyl)methanone |
| SMILES | CCCCCCOc1ccc(C(=O)c2ccccc2O)c(O)c1 |
| InChI | InChI=1S/C19H22O4/c1-2-3-4-7-12-23-14-10-11-16(18(21)13-14)19(22)15-8-5-6-9-17(15)20/h5-6,8-11,13,20-21H,2-4,7,12H2,1H3 |
| InChIKey | CRKBNXAOOOPZJV-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|