C20H24O3 — CID 4534112
1-(4-hexoxy-2-hydroxyphenyl)-2-phenylethanone (PubChem CID 4534112) has the molecular formula C20H24O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is 1-(4-hexoxy-2-hydroxyphenyl)-2-phenylethanone.
| Compound Name | 1-(4-hexoxy-2-hydroxyphenyl)-2-phenylethanone |
|---|---|
| PubChem CID | 4534112 |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 1-(4-hexoxy-2-hydroxyphenyl)-2-phenylethanone |
| SMILES | CCCCCCOc1ccc(C(=O)Cc2ccccc2)c(O)c1 |
| InChI | InChI=1S/C20H24O3/c1-2-3-4-8-13-23-17-11-12-18(20(22)15-17)19(21)14-16-9-6-5-7-10-16/h5-7,9-12,15,22H,2-4,8,13-14H2,1H3 |
| InChIKey | CXVNGMFRGZFZTG-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|