C20H25NO3 — CID 135699007
2-[(E)-C-benzyl-N-hydroxycarbonimidoyl]-5-hexoxyphenol (PubChem CID 135699007) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is 2-[(E)-C-benzyl-N-hydroxycarbonimidoyl]-5-hexoxyphenol.
| Compound Name | 2-[(E)-C-benzyl-N-hydroxycarbonimidoyl]-5-hexoxyphenol |
|---|---|
| PubChem CID | 135699007 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 2-[(E)-C-benzyl-N-hydroxycarbonimidoyl]-5-hexoxyphenol |
| SMILES | CCCCCCOc1ccc(/C(Cc2ccccc2)=N/O)c(O)c1 |
| InChI | InChI=1S/C20H25NO3/c1-2-3-4-8-13-24-17-11-12-18(20(22)15-17)19(21-23)14-16-9-6-5-7-10-16/h5-7,9-12,15,22-23H,2-4,8,13-14H2,1H3/b21-19+ |
| InChIKey | IZYXGPGKRDKQJP-XUTLUUPISA-N |
| XLogP | 4.77 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|