C24H33NO3 — CID 135717091
2-[(Z)-C-benzyl-N-hydroxycarbonimidoyl]-5-decoxyphenol (PubChem CID 135717091) has the molecular formula C24H33NO3 and a molecular weight of 383.53 g/mol. Its IUPAC name is 2-[(Z)-C-benzyl-N-hydroxycarbonimidoyl]-5-decoxyphenol.
| Compound Name | 2-[(Z)-C-benzyl-N-hydroxycarbonimidoyl]-5-decoxyphenol |
|---|---|
| PubChem CID | 135717091 |
| Molecular Formula | C24H33NO3 |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | 2-[(Z)-C-benzyl-N-hydroxycarbonimidoyl]-5-decoxyphenol |
| SMILES | CCCCCCCCCCOc1ccc(/C(Cc2ccccc2)=N\O)c(O)c1 |
| InChI | InChI=1S/C24H33NO3/c1-2-3-4-5-6-7-8-12-17-28-21-15-16-22(24(26)19-21)23(25-27)18-20-13-10-9-11-14-20/h9-11,13-16,19,26-27H,2-8,12,17-18H2,1H3/b25-23- |
| InChIKey | WVUVSQXIHNPGDV-BZZOAKBMSA-N |
| XLogP | 6.33 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|