C21H28O2 — CID 143162484
2-benzyl-5-octoxyphenol (PubChem CID 143162484) has the molecular formula C21H28O2 and a molecular weight of 312.45 g/mol. Its IUPAC name is 2-benzyl-5-octoxyphenol.
| Compound Name | 2-benzyl-5-octoxyphenol |
|---|---|
| PubChem CID | 143162484 |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | 2-benzyl-5-octoxyphenol |
| SMILES | CCCCCCCCOc1ccc(Cc2ccccc2)c(O)c1 |
| InChI | InChI=1S/C21H28O2/c1-2-3-4-5-6-10-15-23-20-14-13-19(21(22)17-20)16-18-11-8-7-9-12-18/h7-9,11-14,17,22H,2-6,10,15-16H2,1H3 |
| InChIKey | NHMGJOVFOGKJTA-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|