C12H18O3 — CID 23459322
4-hexoxybenzene-1,2-diol (PubChem CID 23459322) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is 4-hexoxybenzene-1,2-diol.
| Compound Name | 4-hexoxybenzene-1,2-diol |
|---|---|
| PubChem CID | 23459322 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 4-hexoxybenzene-1,2-diol |
| SMILES | CCCCCCOc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C12H18O3/c1-2-3-4-5-8-15-10-6-7-11(13)12(14)9-10/h6-7,9,13-14H,2-5,8H2,1H3 |
| InChIKey | OASMJFHIFBZZSP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|