C34H50O6 — CID 11757389
1,2-bis(5-decoxy-2-hydroxyphenyl)ethane-1,2-dione (PubChem CID 11757389) has the molecular formula C34H50O6 and a molecular weight of 554.77 g/mol. Its IUPAC name is 1,2-bis(5-decoxy-2-hydroxyphenyl)ethane-1,2-dione.
| Compound Name | 1,2-bis(5-decoxy-2-hydroxyphenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 11757389 |
| Molecular Formula | C34H50O6 |
| Molecular Weight | 554.77 g/mol |
| Exact Mass | 554.36 |
| IUPAC Name | 1,2-bis(5-decoxy-2-hydroxyphenyl)ethane-1,2-dione |
| SMILES | CCCCCCCCCCOc1ccc(O)c(C(=O)C(=O)c2cc(OCCCCCCCCCC)ccc2O)c1 |
| InChI | InChI=1S/C34H50O6/c1-3-5-7-9-11-13-15-17-23-39-27-19-21-31(35)29(25-27)33(37)34(38)30-26-28(20-22-32(30)36)40-24-18-16-14-12-10-8-6-4-2/h19-22,25-26,35-36H,3-18,23-24H2,1-2H3 |
| InChIKey | KWXLVJWLQRVUIF-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.77 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|