About 2-amino-5-heptoxybenzoic acid
2-amino-5-heptoxybenzoic acid (PubChem CID 54888058) has the molecular formula C14H21NO3
and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-amino-5-heptoxybenzoic acid.
Molecular Properties
| Compound Name | 2-amino-5-heptoxybenzoic acid |
| PubChem CID | 54888058 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 2-amino-5-heptoxybenzoic acid |
| SMILES | CCCCCCCOc1ccc(N)c(C(=O)O)c1 |
| InChI | InChI=1S/C14H21NO3/c1-2-3-4-5-6-9-18-11-7-8-13(15)12(10-11)14(16)17/h7-8,10H,2-6,9,15H2,1H3,(H,16,17) |
| InChIKey | LVTPFWYIOXXESS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-5-heptoxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-heptoxybenzoic acid?
The IUPAC name of 2-amino-5-heptoxybenzoic acid (CID 54888058) is 2-amino-5-heptoxybenzoic acid.
What is the SMILES notation for 2-amino-5-heptoxybenzoic acid?
The canonical SMILES for 2-amino-5-heptoxybenzoic acid is CCCCCCCOc1ccc(N)c(C(=O)O)c1.
What is the InChIKey of 2-amino-5-heptoxybenzoic acid?
The InChIKey is LVTPFWYIOXXESS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO3/c1-2-3-4-5-6-9-18-11-7-8-13(15)12(10-11)14(16)17/h7-8,10H,2-6,9,15H2,1H3,(H,16,17).
What are the key properties of 2-amino-5-heptoxybenzoic acid?
2-amino-5-heptoxybenzoic acid has a molecular weight of 251.33 g/mol, XLogP of 3.32, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-heptoxybenzoic acid is sourced from PubChem (CID 54888058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).