About 2-methyl-4-nonoxyaniline
2-methyl-4-nonoxyaniline (PubChem CID 43128997) has the molecular formula C16H27NO
and a molecular weight of 249.40 g/mol. Its IUPAC name is 2-methyl-4-nonoxyaniline.
Molecular Properties
| Compound Name | 2-methyl-4-nonoxyaniline |
| PubChem CID | 43128997 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | 2-methyl-4-nonoxyaniline |
| SMILES | CCCCCCCCCOc1ccc(N)c(C)c1 |
| InChI | InChI=1S/C16H27NO/c1-3-4-5-6-7-8-9-12-18-15-10-11-16(17)14(2)13-15/h10-11,13H,3-9,12,17H2,1-2H3 |
| InChIKey | CYUVEJQLCZXJBP-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-4-nonoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-nonoxyaniline?
The IUPAC name of 2-methyl-4-nonoxyaniline (CID 43128997) is 2-methyl-4-nonoxyaniline.
What is the SMILES notation for 2-methyl-4-nonoxyaniline?
The canonical SMILES for 2-methyl-4-nonoxyaniline is CCCCCCCCCOc1ccc(N)c(C)c1.
What is the InChIKey of 2-methyl-4-nonoxyaniline?
The InChIKey is CYUVEJQLCZXJBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27NO/c1-3-4-5-6-7-8-9-12-18-15-10-11-16(17)14(2)13-15/h10-11,13H,3-9,12,17H2,1-2H3.
What are the key properties of 2-methyl-4-nonoxyaniline?
2-methyl-4-nonoxyaniline has a molecular weight of 249.40 g/mol, XLogP of 4.71, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-nonoxyaniline is sourced from PubChem (CID 43128997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).