C13H22N2O — CID 54795786
4-heptoxybenzene-1,2-diamine (PubChem CID 54795786) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 4-heptoxybenzene-1,2-diamine.
| Compound Name | 4-heptoxybenzene-1,2-diamine |
|---|---|
| PubChem CID | 54795786 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 4-heptoxybenzene-1,2-diamine |
| SMILES | CCCCCCCOc1ccc(N)c(N)c1 |
| InChI | InChI=1S/C13H22N2O/c1-2-3-4-5-6-9-16-11-7-8-12(14)13(15)10-11/h7-8,10H,2-6,9,14-15H2,1H3 |
| InChIKey | SIBLNZAGFBMKOP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|