C16H26O2 — CID 18314717
1,4-dipentoxybenzene (PubChem CID 18314717) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 1,4-dipentoxybenzene.
| Compound Name | 1,4-dipentoxybenzene |
|---|---|
| PubChem CID | 18314717 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 1,4-dipentoxybenzene |
| SMILES | CCCCCOc1ccc(OCCCCC)cc1 |
| InChI | InChI=1S/C16H26O2/c1-3-5-7-13-17-15-9-11-16(12-10-15)18-14-8-6-4-2/h9-12H,3-8,13-14H2,1-2H3 |
| InChIKey | AZRBANUVPNINHV-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|