About 1-hexoxy-4-pentylbenzene
1-hexoxy-4-pentylbenzene (PubChem CID 54277450) has the molecular formula C17H28O
and a molecular weight of 248.41 g/mol. Its IUPAC name is 1-hexoxy-4-pentylbenzene.
Molecular Properties
| Compound Name | 1-hexoxy-4-pentylbenzene |
| PubChem CID | 54277450 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | 1-hexoxy-4-pentylbenzene |
| SMILES | CCCCCCOc1ccc(CCCCC)cc1 |
| InChI | InChI=1S/C17H28O/c1-3-5-7-9-15-18-17-13-11-16(12-14-17)10-8-6-4-2/h11-14H,3-10,15H2,1-2H3 |
| InChIKey | FCUNFTSBJDDTQK-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-hexoxy-4-pentylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hexoxy-4-pentylbenzene?
The IUPAC name of 1-hexoxy-4-pentylbenzene (CID 54277450) is 1-hexoxy-4-pentylbenzene.
What is the SMILES notation for 1-hexoxy-4-pentylbenzene?
The canonical SMILES for 1-hexoxy-4-pentylbenzene is CCCCCCOc1ccc(CCCCC)cc1.
What is the InChIKey of 1-hexoxy-4-pentylbenzene?
The InChIKey is FCUNFTSBJDDTQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O/c1-3-5-7-9-15-18-17-13-11-16(12-14-17)10-8-6-4-2/h11-14H,3-10,15H2,1-2H3.
What are the key properties of 1-hexoxy-4-pentylbenzene?
1-hexoxy-4-pentylbenzene has a molecular weight of 248.41 g/mol, XLogP of 5.38, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hexoxy-4-pentylbenzene is sourced from PubChem (CID 54277450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).