C17H28O2 — CID 91210467
1-hexyl-4-(2-propoxyethoxy)benzene (PubChem CID 91210467) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is 1-hexyl-4-(2-propoxyethoxy)benzene.
| Compound Name | 1-hexyl-4-(2-propoxyethoxy)benzene |
|---|---|
| PubChem CID | 91210467 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 1-hexyl-4-(2-propoxyethoxy)benzene |
| SMILES | CCCCCCc1ccc(OCCOCCC)cc1 |
| InChI | InChI=1S/C17H28O2/c1-3-5-6-7-8-16-9-11-17(12-10-16)19-15-14-18-13-4-2/h9-12H,3-8,13-15H2,1-2H3 |
| InChIKey | HKQDGFDFLOMUSD-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|