C20H35NaO5S — CID 173317917
sodium;hydride;2-[2-(4-octylphenoxy)ethoxy]ethyl ethanesulfonate (PubChem CID 173317917) has the molecular formula C20H35NaO5S and a molecular weight of 410.55 g/mol. Its IUPAC name is sodium;hydride;2-[2-(4-octylphenoxy)ethoxy]ethyl ethanesulfonate.
| Compound Name | sodium;hydride;2-[2-(4-octylphenoxy)ethoxy]ethyl ethanesulfonate |
|---|---|
| PubChem CID | 173317917 |
| Molecular Formula | C20H35NaO5S |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | sodium;hydride;2-[2-(4-octylphenoxy)ethoxy]ethyl ethanesulfonate |
| SMILES | CCCCCCCCc1ccc(OCCOCCOS(=O)(=O)CC)cc1.[H-].[Na+] |
| InChI | InChI=1S/C20H34O5S.Na.H/c1-3-5-6-7-8-9-10-19-11-13-20(14-12-19)24-17-15-23-16-18-25-26(21,22)4-2;;/h11-14H,3-10,15-18H2,1-2H3;;/q;+1;-1 |
| InChIKey | HDNBVPIPLJQMTP-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|