C18H30O4S — CID 57186582
2-(4-octylphenoxy)ethyl ethanesulfonate (PubChem CID 57186582) has the molecular formula C18H30O4S and a molecular weight of 342.50 g/mol. Its IUPAC name is 2-(4-octylphenoxy)ethyl ethanesulfonate.
| Compound Name | 2-(4-octylphenoxy)ethyl ethanesulfonate |
|---|---|
| PubChem CID | 57186582 |
| Molecular Formula | C18H30O4S |
| Molecular Weight | 342.50 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 2-(4-octylphenoxy)ethyl ethanesulfonate |
| SMILES | CCCCCCCCc1ccc(OCCOS(=O)(=O)CC)cc1 |
| InChI | InChI=1S/C18H30O4S/c1-3-5-6-7-8-9-10-17-11-13-18(14-12-17)21-15-16-22-23(19,20)4-2/h11-14H,3-10,15-16H2,1-2H3 |
| InChIKey | IZTAYWHDSQQBFG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|