C16H25NaO4S — CID 22947527
sodium 2-(4-octylphenoxy)ethanesulfonate (PubChem CID 22947527) has the molecular formula C16H25NaO4S and a molecular weight of 336.43 g/mol. Its IUPAC name is sodium 2-(4-octylphenoxy)ethanesulfonate.
| Compound Name | sodium 2-(4-octylphenoxy)ethanesulfonate |
|---|---|
| PubChem CID | 22947527 |
| Molecular Formula | C16H25NaO4S |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | sodium 2-(4-octylphenoxy)ethanesulfonate |
| SMILES | CCCCCCCCc1ccc(OCCS(=O)(=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C16H26O4S.Na/c1-2-3-4-5-6-7-8-15-9-11-16(12-10-15)20-13-14-21(17,18)19;/h9-12H,2-8,13-14H2,1H3,(H,17,18,19);/q;+1/p-1 |
| InChIKey | BZAKWAKOHHBMSJ-UHFFFAOYSA-M |
| XLogP | 0.52 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|