C34H54O9PS- — CID 101180976
2-[2-[2-[2-[2-[2-[2-(4-octylphenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl-phenylphosphanyl]ethanesulfonate (PubChem CID 101180976) has the molecular formula C34H54O9PS- and a molecular weight of 669.84 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-[2-(4-octylphenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl-phenylphosphanyl]ethanesulfonate.
| Compound Name | 2-[2-[2-[2-[2-[2-[2-(4-octylphenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl-phenylphosphanyl]ethanesulfonate |
|---|---|
| PubChem CID | 101180976 |
| Molecular Formula | C34H54O9PS- |
| Molecular Weight | 669.84 g/mol |
| Exact Mass | 669.32 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-[2-(4-octylphenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl-phenylphosphanyl]ethanesulfonate |
| SMILES | CCCCCCCCc1ccc(OCCOCCOCCOCCOCCOCCP(CCS(=O)(=O)[O-])c2ccccc2)cc1 |
| InChI | InChI=1S/C34H55O9PS/c1-2-3-4-5-6-8-11-32-14-16-33(17-15-32)43-27-26-41-23-22-39-19-18-38-20-21-40-24-25-42-28-29-44(30-31-45(35,36)37)34-12-9-7-10-13-34/h7,9-10,12-17H,2-6,8,11,18-31H2,1H3,(H,35,36,37)/p-1 |
| InChIKey | PLUJIOXSGHLVKX-UHFFFAOYSA-M |
| XLogP | 5.40 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.84 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|