C24H34O4PS- — CID 101180982
2-[phenyl-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethyl]phosphanyl]ethanesulfonate (PubChem CID 101180982) has the molecular formula C24H34O4PS- and a molecular weight of 449.57 g/mol. Its IUPAC name is 2-[phenyl-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethyl]phosphanyl]ethanesulfonate.
| Compound Name | 2-[phenyl-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethyl]phosphanyl]ethanesulfonate |
|---|---|
| PubChem CID | 101180982 |
| Molecular Formula | C24H34O4PS- |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 2-[phenyl-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethyl]phosphanyl]ethanesulfonate |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(OCCP(CCS(=O)(=O)[O-])c2ccccc2)cc1 |
| InChI | InChI=1S/C24H35O4PS/c1-23(2,3)19-24(4,5)20-11-13-21(14-12-20)28-15-16-29(17-18-30(25,26)27)22-9-7-6-8-10-22/h6-14H,15-19H2,1-5H3,(H,25,26,27)/p-1 |
| InChIKey | PIBDCXHKMCYIAI-UHFFFAOYSA-M |
| XLogP | 5.13 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|