C60H90O9 — CID 139243319
1,3,5-tris[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethoxy]benzene (PubChem CID 139243319) has the molecular formula C60H90O9 and a molecular weight of 955.37 g/mol. Its IUPAC name is 1,3,5-tris[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethoxy]benzene.
| Compound Name | 1,3,5-tris[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethoxy]benzene |
|---|---|
| PubChem CID | 139243319 |
| Molecular Formula | C60H90O9 |
| Molecular Weight | 955.37 g/mol |
| Exact Mass | 954.66 |
| IUPAC Name | 1,3,5-tris[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethoxy]benzene |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(OCCOCCOc2cc(OCCOCCOc3ccc(C(C)(C)CC(C)(C)C)cc3)cc(OCCOCCOc3ccc(C(C)(C)CC(C)(C)C)cc3)c2)cc1 |
| InChI | InChI=1S/C60H90O9/c1-55(2,3)43-58(10,11)46-16-22-49(23-17-46)64-34-28-61-31-37-67-52-40-53(68-38-32-62-29-35-65-50-24-18-47(19-25-50)59(12,13)44-56(4,5)6)42-54(41-52)69-39-33-63-30-36-66-51-26-20-48(21-27-51)60(14,15)45-57(7,8)9/h16-27,40-42H,28-39,43-45H2,1-15H3 |
| InChIKey | DWTHRFBPWLSXGH-UHFFFAOYSA-N |
| XLogP | 14.25 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 955.37 |
| LogP ≤ 5 | 14.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|