C20H36ClNO2 — CID 173054273
2-methyl-1-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]propan-2-amine;hydrochloride (PubChem CID 173054273) has the molecular formula C20H36ClNO2 and a molecular weight of 357.97 g/mol. Its IUPAC name is 2-methyl-1-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]propan-2-amine;hydrochloride.
| Compound Name | 2-methyl-1-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]propan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 173054273 |
| Molecular Formula | C20H36ClNO2 |
| Molecular Weight | 357.97 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | 2-methyl-1-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]propan-2-amine;hydrochloride |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(OCCOCC(C)(C)N)cc1.Cl |
| InChI | InChI=1S/C20H35NO2.ClH/c1-18(2,3)14-19(4,5)16-8-10-17(11-9-16)23-13-12-22-15-20(6,7)21;/h8-11H,12-15,21H2,1-7H3;1H |
| InChIKey | RBJWZVVRYDTANT-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.97 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|