C26H46O10S — CID 101340597
2-[2-[2-[2-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl hydrogen sulfate (PubChem CID 101340597) has the molecular formula C26H46O10S and a molecular weight of 550.71 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl hydrogen sulfate.
| Compound Name | 2-[2-[2-[2-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl hydrogen sulfate |
|---|---|
| PubChem CID | 101340597 |
| Molecular Formula | C26H46O10S |
| Molecular Weight | 550.71 g/mol |
| Exact Mass | 550.28 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl hydrogen sulfate |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(OCCOCCOCCOCCOCCOCCOS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C26H46O10S/c1-25(2,3)22-26(4,5)23-6-8-24(9-7-23)35-20-18-33-16-14-31-12-10-30-11-13-32-15-17-34-19-21-36-37(27,28)29/h6-9H,10-22H2,1-5H3,(H,27,28,29) |
| InChIKey | SRCMKAPGNQZHIJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.71 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|