C20H36ClNO2 — CID 118296277
dimethyl-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethyl]azanium chloride (PubChem CID 118296277) has the molecular formula C20H36ClNO2 and a molecular weight of 357.97 g/mol. Its IUPAC name is dimethyl-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethyl]azanium chloride.
| Compound Name | dimethyl-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethyl]azanium chloride |
|---|---|
| PubChem CID | 118296277 |
| Molecular Formula | C20H36ClNO2 |
| Molecular Weight | 357.97 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | dimethyl-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethyl]azanium chloride |
| SMILES | C[NH+](C)CCOCCOc1ccc(C(C)(C)CC(C)(C)C)cc1.[Cl-] |
| InChI | InChI=1S/C20H35NO2.ClH/c1-19(2,3)16-20(4,5)17-8-10-18(11-9-17)23-15-14-22-13-12-21(6)7;/h8-11H,12-16H2,1-7H3;1H |
| InChIKey | UDWVJHFQSDRCQS-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 22.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.97 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|