C18H34O3 — CID 144516438
ethane;2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethanol;hydrate (PubChem CID 144516438) has the molecular formula C18H34O3 and a molecular weight of 298.47 g/mol. Its IUPAC name is ethane;2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethanol;hydrate.
| Compound Name | ethane;2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethanol;hydrate |
|---|---|
| PubChem CID | 144516438 |
| Molecular Formula | C18H34O3 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.25 |
| IUPAC Name | ethane;2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethanol;hydrate |
| SMILES | CC.CC(C)(C)CC(C)(C)c1ccc(OCCO)cc1.O |
| InChI | InChI=1S/C16H26O2.C2H6.H2O/c1-15(2,3)12-16(4,5)13-6-8-14(9-7-13)18-11-10-17;1-2;/h6-9,17H,10-12H2,1-5H3;1-2H3;1H2 |
| InChIKey | WGWBIPJSGSZJAU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 60.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |