C23H30O4 — CID 22681637
2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]benzoic acid (PubChem CID 22681637) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is 2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]benzoic acid.
| Compound Name | 2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 22681637 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]benzoic acid |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(OCCOc2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C23H30O4/c1-22(2,3)16-23(4,5)17-10-12-18(13-11-17)26-14-15-27-20-9-7-6-8-19(20)21(24)25/h6-13H,14-16H2,1-5H3,(H,24,25) |
| InChIKey | WPCINHKJJJFVRC-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|