C21H38ClNO2 — CID 174237647
2-methyl-3-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]butan-2-amine;hydrochloride (PubChem CID 174237647) has the molecular formula C21H38ClNO2 and a molecular weight of 371.99 g/mol. Its IUPAC name is 2-methyl-3-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]butan-2-amine;hydrochloride.
| Compound Name | 2-methyl-3-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]butan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 174237647 |
| Molecular Formula | C21H38ClNO2 |
| Molecular Weight | 371.99 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | 2-methyl-3-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]butan-2-amine;hydrochloride |
| SMILES | CC(OCCOc1ccc(C(C)(C)CC(C)(C)C)cc1)C(C)(C)N.Cl |
| InChI | InChI=1S/C21H37NO2.ClH/c1-16(21(7,8)22)23-13-14-24-18-11-9-17(10-12-18)20(5,6)15-19(2,3)4;/h9-12,16H,13-15,22H2,1-8H3;1H |
| InChIKey | PNOLZNPEVKCUFD-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.99 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|