C27H42NO3+ — CID 177328486
(4-hydroxyphenyl)methyl-dimethyl-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethyl]azanium (PubChem CID 177328486) has the molecular formula C27H42NO3+ and a molecular weight of 428.64 g/mol. Its IUPAC name is (4-hydroxyphenyl)methyl-dimethyl-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethyl]azanium.
| Compound Name | (4-hydroxyphenyl)methyl-dimethyl-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethyl]azanium |
|---|---|
| PubChem CID | 177328486 |
| Molecular Formula | C27H42NO3+ |
| Molecular Weight | 428.64 g/mol |
| Exact Mass | 428.32 |
| IUPAC Name | (4-hydroxyphenyl)methyl-dimethyl-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethyl]azanium |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(OCCOCC[N+](C)(C)Cc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C27H41NO3/c1-26(2,3)21-27(4,5)23-10-14-25(15-11-23)31-19-18-30-17-16-28(6,7)20-22-8-12-24(29)13-9-22/h8-15H,16-21H2,1-7H3/p+1 |
| InChIKey | BCHBYFJZOYMTPC-UHFFFAOYSA-O |
| XLogP | 5.78 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.64 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|