C31H49Br2NO3 — CID 177328319
[4-(3-bromobutoxy)phenyl]methyl-dimethyl-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethyl]azanium bromide (PubChem CID 177328319) has the molecular formula C31H49Br2NO3 and a molecular weight of 643.55 g/mol. Its IUPAC name is [4-(3-bromobutoxy)phenyl]methyl-dimethyl-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethyl]azanium bromide.
| Compound Name | [4-(3-bromobutoxy)phenyl]methyl-dimethyl-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethyl]azanium bromide |
|---|---|
| PubChem CID | 177328319 |
| Molecular Formula | C31H49Br2NO3 |
| Molecular Weight | 643.55 g/mol |
| Exact Mass | 641.21 |
| IUPAC Name | [4-(3-bromobutoxy)phenyl]methyl-dimethyl-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethyl]azanium bromide |
| SMILES | CC(Br)CCOc1ccc(C[N+](C)(C)CCOCCOc2ccc(C(C)(C)CC(C)(C)C)cc2)cc1.[Br-] |
| InChI | InChI=1S/C31H49BrNO3.BrH/c1-25(32)17-19-35-28-13-9-26(10-14-28)23-33(7,8)18-20-34-21-22-36-29-15-11-27(12-16-29)31(5,6)24-30(2,3)4;/h9-16,25H,17-24H2,1-8H3;1H/q+1;/p-1 |
| InChIKey | WFVPHWFMWLCTFF-UHFFFAOYSA-M |
| XLogP | 4.63 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.55 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|