C37H53Br2NO3 — CID 177328378
benzyl-[[4-(4-bromobutoxy)phenyl]methyl]-methyl-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethyl]azanium bromide (PubChem CID 177328378) has the molecular formula C37H53Br2NO3 and a molecular weight of 719.64 g/mol. Its IUPAC name is benzyl-[[4-(4-bromobutoxy)phenyl]methyl]-methyl-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethyl]azanium bromide.
| Compound Name | benzyl-[[4-(4-bromobutoxy)phenyl]methyl]-methyl-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethyl]azanium bromide |
|---|---|
| PubChem CID | 177328378 |
| Molecular Formula | C37H53Br2NO3 |
| Molecular Weight | 719.64 g/mol |
| Exact Mass | 717.24 |
| IUPAC Name | benzyl-[[4-(4-bromobutoxy)phenyl]methyl]-methyl-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethyl]azanium bromide |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(OCCOCC[N+](C)(Cc2ccccc2)Cc2ccc(OCCCCBr)cc2)cc1.[Br-] |
| InChI | InChI=1S/C37H53BrNO3.BrH/c1-36(2,3)30-37(4,5)33-16-20-35(21-17-33)42-27-26-40-25-23-39(6,28-31-12-8-7-9-13-31)29-32-14-18-34(19-15-32)41-24-11-10-22-38;/h7-9,12-21H,10-11,22-30H2,1-6H3;1H/q+1;/p-1 |
| InChIKey | NRMVZVCLHCLUHO-UHFFFAOYSA-M |
| XLogP | 6.20 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.64 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|