C34H47BrNO3+ — CID 177328450
[4-[(2-bromophenyl)methoxy]phenyl]methyl-dimethyl-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethyl]azanium (PubChem CID 177328450) has the molecular formula C34H47BrNO3+ and a molecular weight of 597.66 g/mol. Its IUPAC name is [4-[(2-bromophenyl)methoxy]phenyl]methyl-dimethyl-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethyl]azanium.
| Compound Name | [4-[(2-bromophenyl)methoxy]phenyl]methyl-dimethyl-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethyl]azanium |
|---|---|
| PubChem CID | 177328450 |
| Molecular Formula | C34H47BrNO3+ |
| Molecular Weight | 597.66 g/mol |
| Exact Mass | 596.27 |
| IUPAC Name | [4-[(2-bromophenyl)methoxy]phenyl]methyl-dimethyl-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethyl]azanium |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(OCCOCC[N+](C)(C)Cc2ccc(OCc3ccccc3Br)cc2)cc1 |
| InChI | InChI=1S/C34H47BrNO3/c1-33(2,3)26-34(4,5)29-14-18-30(19-15-29)38-23-22-37-21-20-36(6,7)24-27-12-16-31(17-13-27)39-25-28-10-8-9-11-32(28)35/h8-19H,20-26H2,1-7H3/q+1 |
| InChIKey | NVZMEJLVIUCBOB-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.66 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|