C35H58NO2+ — CID 134295314
benzyl-[2-[2-[4-(2,4,4,6,6,8,8-heptamethylnonan-2-yl)phenoxy]ethoxy]ethyl]-dimethylazanium (PubChem CID 134295314) has the molecular formula C35H58NO2+ and a molecular weight of 524.85 g/mol. Its IUPAC name is benzyl-[2-[2-[4-(2,4,4,6,6,8,8-heptamethylnonan-2-yl)phenoxy]ethoxy]ethyl]-dimethylazanium.
| Compound Name | benzyl-[2-[2-[4-(2,4,4,6,6,8,8-heptamethylnonan-2-yl)phenoxy]ethoxy]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 134295314 |
| Molecular Formula | C35H58NO2+ |
| Molecular Weight | 524.85 g/mol |
| Exact Mass | 524.45 |
| IUPAC Name | benzyl-[2-[2-[4-(2,4,4,6,6,8,8-heptamethylnonan-2-yl)phenoxy]ethoxy]ethyl]-dimethylazanium |
| SMILES | CC(C)(C)CC(C)(C)CC(C)(C)CC(C)(C)c1ccc(OCCOCC[N+](C)(C)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C35H58NO2/c1-32(2,3)26-33(4,5)27-34(6,7)28-35(8,9)30-17-19-31(20-18-30)38-24-23-37-22-21-36(10,11)25-29-15-13-12-14-16-29/h12-20H,21-28H2,1-11H3/q+1 |
| InChIKey | MBPDPZXUOYKPJQ-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.85 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|