C27H41ClNO2+ — CID 87594300
benzyl-[2-[2-[4-(1-chloro-2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethyl]-dimethylazanium (PubChem CID 87594300) has the molecular formula C27H41ClNO2+ and a molecular weight of 447.08 g/mol. Its IUPAC name is benzyl-[2-[2-[4-(1-chloro-2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethyl]-dimethylazanium.
| Compound Name | benzyl-[2-[2-[4-(1-chloro-2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 87594300 |
| Molecular Formula | C27H41ClNO2+ |
| Molecular Weight | 447.08 g/mol |
| Exact Mass | 446.28 |
| IUPAC Name | benzyl-[2-[2-[4-(1-chloro-2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethyl]-dimethylazanium |
| SMILES | CC(C)(C)CC(C)(CCl)c1ccc(OCCOCC[N+](C)(C)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C27H41ClNO2/c1-26(2,3)21-27(4,22-28)24-12-14-25(15-13-24)31-19-18-30-17-16-29(5,6)20-23-10-8-7-9-11-23/h7-15H,16-22H2,1-6H3/q+1 |
| InChIKey | BGOBUCSQJZXYPY-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.08 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|