C55H68NO3P+2 — CID 177328443
benzyl-methyl-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethyl]-[[4-(4-triphenylphosphaniumylbutoxy)phenyl]methyl]azanium (PubChem CID 177328443) has the molecular formula C55H68NO3P+2 and a molecular weight of 822.13 g/mol. Its IUPAC name is benzyl-methyl-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethyl]-[[4-(4-triphenylphosphaniumylbutoxy)phenyl]methyl]azanium.
| Compound Name | benzyl-methyl-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethyl]-[[4-(4-triphenylphosphaniumylbutoxy)phenyl]methyl]azanium |
|---|---|
| PubChem CID | 177328443 |
| Molecular Formula | C55H68NO3P+2 |
| Molecular Weight | 822.13 g/mol |
| Exact Mass | 821.49 |
| IUPAC Name | benzyl-methyl-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethyl]-[[4-(4-triphenylphosphaniumylbutoxy)phenyl]methyl]azanium |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(OCCOCC[N+](C)(Cc2ccccc2)Cc2ccc(OCCCC[P+](c3ccccc3)(c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C55H68NO3P/c1-54(2,3)45-55(4,5)48-31-35-50(36-32-48)59-41-40-57-39-37-56(6,43-46-21-11-7-12-22-46)44-47-29-33-49(34-30-47)58-38-19-20-42-60(51-23-13-8-14-24-51,52-25-15-9-16-26-52)53-27-17-10-18-28-53/h7-18,21-36H,19-20,37-45H2,1-6H3/q+2 |
| InChIKey | AJNVHWGWTJTFRL-UHFFFAOYSA-N |
| XLogP | 11.80 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.13 |
| LogP ≤ 5 | 11.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|